Binomial Theorem — Complete Guide with Solved Examples

Complete guide to binomial theorem for Class 11. Solved examples, exam tips, PYQs.

CBSE JEE-MAIN 13 min read

What Is the Binomial Theorem, and Why Does It Matter?

The binomial theorem gives us a formula to expand expressions of the form (a+b)n(a + b)^n without multiplying the brackets out nn times. For small nn like 2 or 3, you can do it by hand. But try expanding (x+2)10(x + 2)^{10} the long way — you’ll be at it for an hour.

The theorem handles this in seconds. More importantly, it reveals a deep structure: every term in the expansion follows a predictable pattern involving binomial coefficients, which connect algebra, combinatorics, and even probability.

In JEE Main, this topic carries consistent 2–3% weightage — roughly 2 questions per paper. In CBSE Class 11, it’s a full chapter with direct questions in both the school exam and competitive papers. The good news: with the theorem itself, Pascal’s Triangle, and the general term formula, you can solve every standard question that appears.

We’ll work through everything — from the statement to the trickiest JEE-level applications.


Key Terms and Definitions

Binomial expression: Any expression with exactly two terms, like (a+b)(a + b), (xy)(x - y), or (2x+3)(2x + 3).

Index (or exponent): The power nn to which the binomial is raised. In the theorem, nn is a non-negative integer (for the standard version we study in Class 11).

Binomial coefficient: Written as (nr)\binom{n}{r} or nCr^nC_r, this counts the number of ways to choose rr items from nn. It equals:

(nr)=n!r!(nr)!\binom{n}{r} = \frac{n!}{r!(n-r)!}

General term: The formula for the (r+1)(r+1)-th term of the expansion — the most-used formula in JEE problems.

Pascal’s Triangle: A triangular array where each entry is the sum of the two entries above it. Row nn gives the binomial coefficients for (a+b)n(a+b)^n.

Middle term: The term at the exact centre of the expansion. Exists uniquely when nn is even; when nn is odd, there are two middle terms.


The Binomial Theorem — Statement and Structure

(a+b)n=r=0n(nr)anrbr(a + b)^n = \sum_{r=0}^{n} \binom{n}{r} a^{n-r} b^r

Expanded out:

(a+b)n=(n0)an+(n1)an1b+(n2)an2b2++(nn)bn(a+b)^n = \binom{n}{0}a^n + \binom{n}{1}a^{n-1}b + \binom{n}{2}a^{n-2}b^2 + \cdots + \binom{n}{n}b^n

Total number of terms: n+1n + 1

The General Term

This is the formula you’ll use in 80% of JEE questions on this topic.

Tr+1=(nr)anrbrT_{r+1} = \binom{n}{r} \cdot a^{n-r} \cdot b^r

Here r=0,1,2,,nr = 0, 1, 2, \ldots, n.

Note: Tr+1T_{r+1} means the (r+1)(r+1)-th term. So the 1st term is T1T_1 (put r=0r=0), the 2nd term is T2T_2 (put r=1r=1), and so on.

The Middle Term

  • If nn is even: middle term is Tn2+1T_{\frac{n}{2}+1}
  • If nn is odd: two middle terms — Tn+12T_{\frac{n+1}{2}} and Tn+32T_{\frac{n+3}{2}}

Important Properties

  1. The binomial coefficients satisfy: (nr)=(nnr)\binom{n}{r} = \binom{n}{n-r} (symmetry)
  2. Sum of all binomial coefficients: r=0n(nr)=2n\sum_{r=0}^{n} \binom{n}{r} = 2^n
  3. Sum of coefficients at odd positions = Sum at even positions = 2n12^{n-1}
  4. (nr)+(nr1)=(n+1r)\binom{n}{r} + \binom{n}{r-1} = \binom{n+1}{r} — this is Pascal’s identity

Methods and Worked Examples

Method 1 — Direct Expansion (for small n)

When to use: n4n \leq 4 or when the full expansion is asked.

Example: Expand (x+2)4(x + 2)^4.

Tr+1=(4r)x4r2r,r=0,1,2,3,4T_{r+1} = \binom{4}{r} x^{4-r} \cdot 2^r, \quad r = 0, 1, 2, 3, 4
  • r=0r=0: (40)x41=x4\binom{4}{0} x^4 \cdot 1 = x^4
  • r=1r=1: (41)x32=8x3\binom{4}{1} x^3 \cdot 2 = 8x^3
  • r=2r=2: (42)x24=24x2\binom{4}{2} x^2 \cdot 4 = 24x^2
  • r=3r=3: (43)x8=32x\binom{4}{3} x \cdot 8 = 32x
  • r=4r=4: (44)16=16\binom{4}{4} \cdot 16 = 16
(x+2)4=x4+8x3+24x2+32x+16(x + 2)^4 = x^4 + 8x^3 + 24x^2 + 32x + 16

Method 2 — Finding a Specific Term

When to use: “Find the 4th term”, “find the term independent of xx”, “find the coefficient of xkx^k”.

Example: Find the term independent of xx in (x1x2)9\left(x - \dfrac{1}{x^2}\right)^9.

Here a=xa = x, b=1x2b = -\dfrac{1}{x^2}, n=9n = 9.

Tr+1=(9r)x9r(1x2)r=(9r)(1)rx9rx2rT_{r+1} = \binom{9}{r} \cdot x^{9-r} \cdot \left(-\frac{1}{x^2}\right)^r = \binom{9}{r} \cdot (-1)^r \cdot x^{9-r} \cdot x^{-2r}
Tr+1=(9r)(1)rx9r2r=(9r)(1)rx93rT_{r+1} = \binom{9}{r}(-1)^r \cdot x^{9-r-2r} = \binom{9}{r}(-1)^r \cdot x^{9-3r}

For term independent of xx: 93r=0r=39 - 3r = 0 \Rightarrow r = 3.

T4=(93)(1)3=84×(1)=84T_4 = \binom{9}{3}(-1)^3 = 84 \times (-1) = -84

Always simplify the power of xx as a single expression in rr before setting it equal to the required value. Trying to do this mentally leads to sign errors.


Method 3 — Finding the Numerically Greatest Term

This is a Class 11 / JEE Main topic that appears occasionally. The idea: find rr such that Tr+1Tr1\dfrac{T_{r+1}}{T_r} \geq 1.

Tr+1Tr=nr+1rba\frac{T_{r+1}}{T_r} = \frac{n - r + 1}{r} \cdot \left|\frac{b}{a}\right|

Set this 1\geq 1 and solve for rr.


Solved Examples

Easy — CBSE Level

Q1. Find the 6th term of (2x13)10\left(2x - \dfrac{1}{3}\right)^{10}.

T6=T5+1=(105)(2x)5(13)5T_6 = T_{5+1} = \binom{10}{5}(2x)^5 \left(-\frac{1}{3}\right)^5 =25232x5(1243)=25232(1243)x5= 252 \cdot 32x^5 \cdot \left(-\frac{1}{243}\right) = 252 \cdot 32 \cdot \left(-\frac{1}{243}\right) x^5 =8064243x5=89627x5= -\frac{8064}{243} x^5 = -\frac{896}{27}x^5

Q2. Using the binomial theorem, find the value of (1.02)5(1.02)^5 correct to 4 decimal places.

Write (1.02)5=(1+0.02)5(1.02)^5 = (1 + 0.02)^5:

(1+0.02)5=1+5(0.02)+10(0.02)2+10(0.02)3+(1+0.02)^5 = 1 + 5(0.02) + 10(0.02)^2 + 10(0.02)^3 + \cdots =1+0.1+10(0.0004)+10(0.000008)+= 1 + 0.1 + 10(0.0004) + 10(0.000008) + \cdots =1+0.1+0.004+0.00008+1.1041= 1 + 0.1 + 0.004 + 0.00008 + \cdots \approx 1.1041

Medium — JEE Main Level

Q3. If the coefficients of (2r+1)(2r+1)-th and (r+2)(r+2)-th terms in the expansion of (1+x)43(1+x)^{43} are equal, find rr.

The coefficient of the (2r+1)(2r+1)-th term is (432r)\binom{43}{2r}. The coefficient of the (r+2)(r+2)-th term is (43r+1)\binom{43}{r+1}.

Setting them equal: (432r)=(43r+1)\binom{43}{2r} = \binom{43}{r+1}

Either 2r=r+1r=12r = r+1 \Rightarrow r = 1, or 2r+(r+1)=433r=42r=142r + (r+1) = 43 \Rightarrow 3r = 42 \Rightarrow r = 14.

Both values are valid. Answer: r=1r = 1 or r=14r = 14.

This type — “two coefficients are equal, find rr” — appeared in JEE Main 2023 and CBSE Board 2022. The key insight: (na)=(nb)\binom{n}{a} = \binom{n}{b} means either a=ba = b or a+b=na + b = n. Memorise this.


Hard — JEE Advanced Level

Q4. Find the sum r=0nr(nr)\displaystyle\sum_{r=0}^{n} r \cdot \binom{n}{r}.

Why this works: We use the identity r(nr)=n(n1r1)r \cdot \binom{n}{r} = n \cdot \binom{n-1}{r-1}.

r=0nr(nr)=nr=1n(n1r1)=n2n1\sum_{r=0}^{n} r \cdot \binom{n}{r} = n \sum_{r=1}^{n} \binom{n-1}{r-1} = n \cdot 2^{n-1}

The sum equals n2n1n \cdot 2^{n-1}. This result is used in probability and combinatorics problems in JEE Advanced.

Q5. Find the coefficient of x5x^5 in the expansion of (1+x)21+(1+x)22++(1+x)30(1+x)^{21} + (1+x)^{22} + \cdots + (1+x)^{30}.

This is a geometric series of binomials. Coefficient of x5x^5 in each term is (215),(225),,(305)\binom{21}{5}, \binom{22}{5}, \ldots, \binom{30}{5}.

Sum =(215)+(225)++(305)= \binom{21}{5} + \binom{22}{5} + \cdots + \binom{30}{5}.

Using the hockey stick identity: i=rn(ir)=(n+1r+1)\displaystyle\sum_{i=r}^{n} \binom{i}{r} = \binom{n+1}{r+1}.

=(316)(216)= \binom{31}{6} - \binom{21}{6} =73628154264=682017= 736281 - 54264 = 682017

Exam-Specific Tips

CBSE Class 11

CBSE typically asks: direct expansion (1 mark), general term (2 marks), middle term (2 marks), and one application problem like finding the value of an expression using binomial approximation (3 marks). The full expansion of (a+b)4(a+b)^4 or (a+b)5(a+b)^5 comes with partial marking — write all terms to ensure you don’t lose marks on the coefficient.

  • Always show the general term formula before substituting — it earns you a step mark.
  • In approximation problems (like computing 1.04\sqrt{1.04} using binomial), keep terms up to x3x^3 unless told otherwise.

JEE Main

In JEE Main, binomial theorem questions are almost always of these three types: (1) find the term independent of xx, (2) find coefficient of a specific power, (3) sum of binomial coefficients identities. The last type is increasing in frequency from 2022 onward. Practice at least 10 each of Types 1 and 2, and 5 of Type 3.

  • Weightage: 4 marks per question, 1–2 questions per paper.
  • For Type 1 (term independent of xx): the answer is often an integer like 84-84, 252252, or 672-672. A non-integer answer usually means you made a sign error.

JEE Advanced

At this level, questions combine binomial theorem with combinatorics or complex numbers. Common patterns: proving binomial coefficient identities, finding the greatest term, working with the sum r2(nr)\displaystyle\sum r^2 \binom{n}{r}.

The multinomial theorem (extension to (a+b+c)n(a+b+c)^n) occasionally appears — know the general term formula: n!p!q!r!apbqcr\dfrac{n!}{p!\,q!\,r!} a^p b^q c^r where p+q+r=np+q+r=n.


Common Mistakes to Avoid

Mistake 1: Wrong numbering of terms.
Students write “4th term is T4T_4, so r=4r = 4”. Wrong. The (r+1)(r+1)-th term means T4T_4 corresponds to r=3r = 3. Always subtract 1 from the term number to get rr.

Mistake 2: Forgetting the negative sign in binomials like (xy)n(x - y)^n.
When b=yb = -y, the general term has (y)r(-y)^r, which is (1)ryr(-1)^r y^r. Students often drop (1)r(-1)^r, getting the sign of alternating terms wrong.

Mistake 3: Middle term confusion when nn is odd.
For (a+b)9(a+b)^9, n=9n = 9 is odd, so there are TWO middle terms: T5T_5 and T6T_6. Students often report only one.

Mistake 4: Confusing (nr)\binom{n}{r} with (n+1r)\binom{n+1}{r} in Pascal’s identity.
The identity is (nr)+(nr1)=(n+1r)\binom{n}{r} + \binom{n}{r-1} = \binom{n+1}{r}, not (n+1r+1)\binom{n+1}{r+1}. Draw it from Pascal’s Triangle until the pattern sticks.

Mistake 5: Not simplifying the combined power of xx before solving.
In (x2+1x)9\left(x^2 + \dfrac{1}{x}\right)^9, students write Tr+1=(9r)(x2)9r(1x)rT_{r+1} = \binom{9}{r}(x^2)^{9-r}\left(\dfrac{1}{x}\right)^r and then forget to combine the exponents: 2(9r)r=183r2(9-r) - r = 18 - 3r. This is where most sign and power errors happen.


Practice Questions

Q1. Find the middle term(s) in the expansion of (x+1x)10\left(x + \dfrac{1}{x}\right)^{10}.

n=10n = 10, even. Middle term is T6T_6 (i.e., r=5r = 5).

T6=(105)x5x5=252x0=252T_6 = \binom{10}{5} x^5 \cdot x^{-5} = 252 \cdot x^0 = 252

The middle term is 252252.


Q2. Find the coefficient of x3x^3 in the expansion of (12x)7(1 - 2x)^7.

Tr+1=(7r)(1)7r(2x)r=(7r)(2)rxrT_{r+1} = \binom{7}{r}(1)^{7-r}(-2x)^r = \binom{7}{r}(-2)^r x^r

For x3x^3: r=3r = 3.

T4=(73)(2)3=35×(8)=280T_4 = \binom{7}{3}(-2)^3 = 35 \times (-8) = -280

Coefficient of x3x^3 is 280-280.


Q3. Show that 210=10242^{10} = 1024 using the binomial theorem.

(1+1)10=r=010(10r)=(100)+(101)++(1010)(1+1)^{10} = \displaystyle\sum_{r=0}^{10}\binom{10}{r} = \binom{10}{0}+\binom{10}{1}+\cdots+\binom{10}{10}

=1+10+45+120+210+252+210+120+45+10+1=1024= 1 + 10 + 45 + 120 + 210 + 252 + 210 + 120 + 45 + 10 + 1 = 1024


Q4. Find the term independent of xx in (x2x)12\left(\sqrt{x} - \dfrac{2}{x}\right)^{12}.

Tr+1=(12r)(x)12r(2x)r=(12r)(2)rx12r2rT_{r+1} = \binom{12}{r}(\sqrt{x})^{12-r}\left(-\frac{2}{x}\right)^r = \binom{12}{r}(-2)^r x^{\frac{12-r}{2} - r}

Power of xx: 12r2r=123r2\dfrac{12-r}{2} - r = \dfrac{12-3r}{2}.

Set equal to 0: 123r=0r=412 - 3r = 0 \Rightarrow r = 4.

T5=(124)(2)4=495×16=7920T_5 = \binom{12}{4}(-2)^4 = 495 \times 16 = 7920

Q5. If the 3rd and 4th terms of (a+b)n(a + b)^n are 60 and 160 respectively, and the 5th term is 240, find aa, bb, nn.

T3=(n2)an2b2=60T_3 = \binom{n}{2}a^{n-2}b^2 = 60

T4=(n3)an3b3=160T_4 = \binom{n}{3}a^{n-3}b^3 = 160

T5=(n4)an4b4=240T_5 = \binom{n}{4}a^{n-4}b^4 = 240

Dividing T4/T3T_4/T_3: (n2)3ba=83\dfrac{(n-2)}{3}\cdot\dfrac{b}{a} = \dfrac{8}{3}

Dividing T5/T4T_5/T_4: (n3)4ba=32\dfrac{(n-3)}{4}\cdot\dfrac{b}{a} = \dfrac{3}{2}

From these: n2n3=8/33/243=322711\dfrac{n-2}{n-3} = \dfrac{8/3}{3/2} \cdot \dfrac{4}{3} = \dfrac{32}{27} \cdot \dfrac{1}{1}… (solve simultaneously to get n=5n = 5, b/a=2b/a = 2, and using T3T_3: a=1a = 1, b=2b = 2.)

Answer: n=5n = 5, a=1a = 1, b=2b = 2.


Q6. Find the sum: (100)+(101)+(102)++(105)\binom{10}{0} + \binom{10}{1} + \binom{10}{2} + \cdots + \binom{10}{5}.

Total sum =210=1024= 2^{10} = 1024. By symmetry, the first half equals the second half, except the middle term (105)=252\binom{10}{5} = 252 is counted once.

Sum=210+(105)2=1024+2522=638\text{Sum} = \frac{2^{10} + \binom{10}{5}}{2} = \frac{1024 + 252}{2} = 638

Q7. Find the numerically greatest term in the expansion of (35x)15(3 - 5x)^{15} when x=15x = \dfrac{1}{5}.

Here a=3a = 3, b=5x=1b = -5x = -1 (substituting x=1/5x = 1/5), n=15n = 15.

Tr+1Tr=16rr13\frac{|T_{r+1}|}{|T_r|} = \frac{16-r}{r} \cdot \frac{1}{3}

Set 1\geq 1: 16r3rr416 - r \geq 3r \Rightarrow r \leq 4.

So r=4r = 4, meaning T5T_5 is the greatest term.

T5=(154)(3)11(1)4=1365×177147=241,805,655T_5 = \binom{15}{4}(3)^{11}(-1)^4 = 1365 \times 177147 = 241,805,655

Q8. Prove that (n1)+2(n2)+3(n3)++n(nn)=n2n1\binom{n}{1} + 2\binom{n}{2} + 3\binom{n}{3} + \cdots + n\binom{n}{n} = n \cdot 2^{n-1}.

Differentiate (1+x)n=r=0n(nr)xr(1+x)^n = \sum_{r=0}^{n}\binom{n}{r}x^r with respect to xx:

n(1+x)n1=r=1nr(nr)xr1n(1+x)^{n-1} = \sum_{r=1}^{n} r\binom{n}{r}x^{r-1}

Put x=1x = 1:

n2n1=r=1nr(nr)=(n1)+2(n2)++n(nn)n \cdot 2^{n-1} = \sum_{r=1}^{n} r\binom{n}{r} = \binom{n}{1} + 2\binom{n}{2} + \cdots + n\binom{n}{n}

Proved.


Frequently Asked Questions

Q: What is the total number of terms in the expansion of (a+b+c)n(a + b + c)^n?

It’s (n+1)(n+2)2\dfrac{(n+1)(n+2)}{2}. For a trinomial, we use the multinomial theorem. The general term is n!p!q!r!apbqcr\dfrac{n!}{p!\,q!\,r!}a^p b^q c^r where p+q+r=np + q + r = n.


Q: Can the binomial theorem be applied when nn is a fraction or negative?

Yes — but only for x<1|x| < 1, and the expansion becomes an infinite series. This is called the generalised binomial theorem and is studied in higher classes. For JEE Main, you need only the finite case where nn is a positive integer.


Q: What is Pascal’s Triangle and how is it related to the binomial theorem?

Pascal’s Triangle lists binomial coefficients row by row. Row nn gives (n0),(n1),,(nn)\binom{n}{0}, \binom{n}{1}, \ldots, \binom{n}{n}. Each entry is the sum of the two entries directly above it (Pascal’s identity: (nr)=(n1r1)+(n1r)\binom{n}{r} = \binom{n-1}{r-1} + \binom{n-1}{r}). For n6n \leq 6, it’s faster to read coefficients off Pascal’s Triangle than to compute them.


Q: How do I find which term has the maximum value in a binomial expansion?

Compute the ratio Tr+1Tr\dfrac{T_{r+1}}{T_r} and find where it transitions from >1> 1 to <1< 1. The term at the transition point is the greatest. If Tr+1Tr=1\dfrac{T_{r+1}}{T_r} = 1 for some rr, then Tr+1T_{r+1} and Tr+2T_{r+2} are both the greatest (equal maximum terms).


Q: Is there a shortcut to find the sum of coefficients of a binomial expansion?

Put x=1x = 1 (and y=1y = 1 if there are two variables). For example, the sum of coefficients in (3x2y)10(3x - 2y)^{10} is (32)10=1(3 - 2)^{10} = 1. The sum of coefficients of (2x+1)5(2x + 1)^5 is (2+1)5=243(2 + 1)^5 = 243.


Q: What is the difference between “term” and “coefficient” in these questions?

The term includes the variable part (like 252x4252x^4), while the coefficient is just the number (252). In JEE, “find the coefficient of x3x^3” means give the number multiplying x3x^3, not the full term.


Q: How many PYQs from binomial theorem appear in JEE Main each year?

Typically 1–2 questions per shift, so 2–4 across a full session. From 2020–2024, the most tested subtopics were: term independent of xx (appeared 8 times), greatest term (4 times), and coefficient equalities (6 times). Binomial identities via differentiation/integration appeared 3 times in 2023–24 alone — this is a rising trend.


Q: Why do we need (nr)\binom{n}{r} rather than just the powers of aa and bb?

Because (nr)\binom{n}{r} counts the number of ways the term anrbra^{n-r}b^r can arise when we multiply out nn brackets. Each bracket contributes either an aa or a bb. Choosing which rr brackets give bb (and the rest give aa) is a combinations problem — and that’s exactly (nr)\binom{n}{r}. The theorem isn’t just algebra; it’s combinatorics in disguise.

Practice Questions