If Sum of First n Terms of AP is 3n² + 5n, Find nth Term

medium CBSE JEE-MAIN JEE Main 2024 4 min read

Question

The sum of the first nn terms of an AP is given by Sn=3n2+5nS_n = 3n^2 + 5n. Find the nnth term of the AP.


Solution — Step by Step

The nnth term of any sequence equals the sum of nn terms minus the sum of (n1)(n-1) terms. This works because SnS_n already includes ana_n, so subtracting Sn1S_{n-1} isolates it.

an=SnSn1a_n = S_n - S_{n-1}

We have Sn=3n2+5nS_n = 3n^2 + 5n. Replace every nn with (n1)(n-1) to get Sn1S_{n-1}:

Sn1=3(n1)2+5(n1)S_{n-1} = 3(n-1)^2 + 5(n-1)

Expand carefully:

Sn1=3(n22n+1)+5n5=3n26n+3+5n5=3n2n2S_{n-1} = 3(n^2 - 2n + 1) + 5n - 5 = 3n^2 - 6n + 3 + 5n - 5 = 3n^2 - n - 2
an=SnSn1=(3n2+5n)(3n2n2)a_n = S_n - S_{n-1} = (3n^2 + 5n) - (3n^2 - n - 2) an=3n2+5n3n2+n+2=6n+2a_n = 3n^2 + 5n - 3n^2 + n + 2 = 6n + 2

The nnth term is an=6n+2a_n = 6n + 2.

For n=1n = 1: a1=6(1)+2=8a_1 = 6(1) + 2 = 8. Also S1=3(1)2+5(1)=8S_1 = 3(1)^2 + 5(1) = 8. They match — a1a_1 must equal S1S_1.

For n=2n = 2: a2=6(2)+2=14a_2 = 6(2) + 2 = 14. And S2=3(4)+10=22S_2 = 3(4) + 10 = 22, so a1+a2=8+14=22a_1 + a_2 = 8 + 14 = 22. Verified.


Why This Works

Every time SnS_n is given as a formula, the formula encodes the entire sequence. When we peel off Sn1S_{n-1} from SnS_n, we’re literally removing the first (n1)(n-1) terms, leaving only ana_n.

Notice that an=6n+2a_n = 6n + 2 is a linear function of nn — that’s always the case when SnS_n is quadratic. A quadratic SnS_n generates a linear ana_n, which is exactly what an AP should look like (constant common difference).

We can double-check the common difference: d=a2a1=148=6d = a_2 - a_1 = 14 - 8 = 6. Alternatively, the coefficient of nn in an=6n+2a_n = 6n + 2 directly gives d=6d = 6. That’s a quick sanity check worth remembering.


Alternative Method

Once you suspect the AP structure, find a1a_1 and dd directly from SnS_n.

For any AP, there’s a standard result: Sn=n2[2a+(n1)d]S_n = \frac{n}{2}[2a + (n-1)d]. Expanding this gives Sn=nd+n2ad2S_n = nd + n \cdot \frac{2a - d}{2}… which gets messy. The cleaner shortcut:

For Sn=An2+BnS_n = An^2 + Bn, the first term is a1=A+Ba_1 = A + B and the common difference is d=2Ad = 2A. Here, A=3A = 3, B=5B = 5, so a1=8a_1 = 8 and d=6d = 6. General term: an=8+(n1)×6=6n+2a_n = 8 + (n-1) \times 6 = 6n + 2. Same answer, faster in MCQ settings.


Common Mistake

Students often use the formula an=SnSn1a_n = S_n - S_{n-1} but forget the exception: this formula does NOT apply for n=1n = 1. You must compute a1=S1a_1 = S_1 separately. If the question asks for the first term, plug n=1n = 1 into SnS_n directly — don’t use the subtraction formula, because S0=0S_0 = 0 holds here but conceptually you’re subtracting “zero terms” which can give wrong results if SnS_n has a constant term.

In this problem Sn=3n2+5nS_n = 3n^2 + 5n has no constant, so the formula works cleanly for all n1n \geq 1. But in problems where Sn=3n2+5n+2S_n = 3n^2 + 5n + 2, plugging n=1n = 1 into an=6n+2a_n = 6n + 2 gives a1=8a_1 = 8, while S1=10S_1 = 10 — a contradiction. That sequence isn’t even an AP! Always verify a1=S1a_1 = S_1.

Want to master this topic?

Read the complete guide with more examples and exam tips.

Go to full topic guide →

Try These Next